C20H21ClN4O5 — CID 135308815
(2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-(5-methoxy-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-10-yl)oxolane-3,4-diol (PubChem CID 135308815) has the molecular formula C20H21ClN4O5 and a molecular weight of 432.86 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-(5-methoxy-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-10-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-(5-methoxy-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-10-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 135308815 |
| Molecular Formula | C20H21ClN4O5 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-(5-methoxy-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-10-yl)oxolane-3,4-diol |
| SMILES | COC1CN=C2c3ccn([C@@H]4O[C@H]([C@H](O)c5ccc(Cl)cc5)[C@@H](O)[C@H]4O)c3N=CN21 |
| InChI | InChI=1S/C20H21ClN4O5/c1-29-13-8-22-18-12-6-7-24(19(12)23-9-25(13)18)20-16(28)15(27)17(30-20)14(26)10-2-4-11(21)5-3-10/h2-7,9,13-17,20,26-28H,8H2,1H3/t13?,14-,15+,16-,17-,20-/m1/s1 |
| InChIKey | JNTYAYKBSNBARW-MDSNGIMYSA-N |
| XLogP | 1.20 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |