C15H21N5O3 — CID 135309522
2-tert-butyl-3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid (PubChem CID 135309522) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-tert-butyl-3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 135309522 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-tert-butyl-3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid |
| SMILES | Cn1cnc2c(OC3CCN(C(=O)O)C3C(C)(C)C)ncnc21 |
| InChI | InChI=1S/C15H21N5O3/c1-15(2,3)11-9(5-6-20(11)14(21)22)23-13-10-12(16-7-17-13)19(4)8-18-10/h7-9,11H,5-6H2,1-4H3,(H,21,22) |
| InChIKey | MYMNLTWZFKRNDO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |