C21H20N2O5S — CID 135310046
4,7-dimethoxy-N-quinolin-5-ylsulfonyl-2,3-dihydro-1H-indene-1-carboxamide (PubChem CID 135310046) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is 4,7-dimethoxy-N-quinolin-5-ylsulfonyl-2,3-dihydro-1H-indene-1-carboxamide.
| Compound Name | 4,7-dimethoxy-N-quinolin-5-ylsulfonyl-2,3-dihydro-1H-indene-1-carboxamide |
|---|---|
| PubChem CID | 135310046 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4,7-dimethoxy-N-quinolin-5-ylsulfonyl-2,3-dihydro-1H-indene-1-carboxamide |
| SMILES | COc1ccc(OC)c2c1CCC2C(=O)NS(=O)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C21H20N2O5S/c1-27-17-10-11-18(28-2)20-14(17)8-9-15(20)21(24)23-29(25,26)19-7-3-6-16-13(19)5-4-12-22-16/h3-7,10-12,15H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | VRTWNTVDPQUHBV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |