C7H7Cl3N2 — CID 135310534
2,5,6-trichloro-4-cyclopropyl-1,4-dihydropyrimidine (PubChem CID 135310534) has the molecular formula C7H7Cl3N2 and a molecular weight of 225.51 g/mol. Its IUPAC name is 2,5,6-trichloro-4-cyclopropyl-1,4-dihydropyrimidine.
| Compound Name | 2,5,6-trichloro-4-cyclopropyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 135310534 |
| Molecular Formula | C7H7Cl3N2 |
| Molecular Weight | 225.51 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | 2,5,6-trichloro-4-cyclopropyl-1,4-dihydropyrimidine |
| SMILES | ClC1=NC(C2CC2)C(Cl)=C(Cl)N1 |
| InChI | InChI=1S/C7H7Cl3N2/c8-4-5(3-1-2-3)11-7(10)12-6(4)9/h3,5H,1-2H2,(H,11,12) |
| InChIKey | XVXMTFJSNNJJOL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|