C27H43NO5 — CID 135311608
methyl (4R)-4-[(3R,5R,7Z,8R,9S,10S,13R,14S,17R)-3-acetyloxy-7-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 135311608) has the molecular formula C27H43NO5 and a molecular weight of 461.64 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5R,7Z,8R,9S,10S,13R,14S,17R)-3-acetyloxy-7-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5R,7Z,8R,9S,10S,13R,14S,17R)-3-acetyloxy-7-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 135311608 |
| Molecular Formula | C27H43NO5 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | methyl (4R)-4-[(3R,5R,7Z,8R,9S,10S,13R,14S,17R)-3-acetyloxy-7-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3/C(=N\O)C[C@@H]4C[C@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H43NO5/c1-16(6-9-24(30)32-5)20-7-8-21-25-22(11-13-27(20,21)4)26(3)12-10-19(33-17(2)29)14-18(26)15-23(25)28-31/h16,18-22,25,31H,6-15H2,1-5H3/b28-23-/t16-,18+,19-,20-,21+,22+,25+,26+,27-/m1/s1 |
| InChIKey | CFWWOHCOBJQMIY-RFSDLUCLSA-N |
| XLogP | 5.61 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|