About 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid
5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid (PubChem CID 135311623) has the molecular formula C11H11BrO4
and a molecular weight of 287.11 g/mol. Its IUPAC name is 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid |
| PubChem CID | 135311623 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid |
| SMILES | COc1ccc(Br)c2c1OCCC2C(=O)O |
| InChI | InChI=1S/C11H11BrO4/c1-15-8-3-2-7(12)9-6(11(13)14)4-5-16-10(8)9/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | KBONATZJQDZFOW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid?
The IUPAC name of 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid (CID 135311623) is 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid.
What is the SMILES notation for 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid?
The canonical SMILES for 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid is COc1ccc(Br)c2c1OCCC2C(=O)O.
What is the InChIKey of 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid?
The InChIKey is KBONATZJQDZFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO4/c1-15-8-3-2-7(12)9-6(11(13)14)4-5-16-10(8)9/h2-3,6H,4-5H2,1H3,(H,13,14).
What are the key properties of 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid?
5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid has a molecular weight of 287.11 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-8-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid is sourced from PubChem (CID 135311623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).