About 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile
8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile (PubChem CID 135311631) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile.
Molecular Properties
| Compound Name | 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile |
| PubChem CID | 135311631 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile |
| SMILES | COc1ccc(Br)c2c1C(C#N)CCO2 |
| InChI | InChI=1S/C11H10BrNO2/c1-14-9-3-2-8(12)11-10(9)7(6-13)4-5-15-11/h2-3,7H,4-5H2,1H3 |
| InChIKey | CPUJMZMSBBSNOZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile?
The IUPAC name of 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile (CID 135311631) is 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile.
What is the SMILES notation for 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile?
The canonical SMILES for 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile is COc1ccc(Br)c2c1C(C#N)CCO2.
What is the InChIKey of 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile?
The InChIKey is CPUJMZMSBBSNOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO2/c1-14-9-3-2-8(12)11-10(9)7(6-13)4-5-15-11/h2-3,7H,4-5H2,1H3.
What are the key properties of 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile?
8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile has a molecular weight of 268.11 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-methoxy-3,4-dihydro-2H-chromene-4-carbonitrile is sourced from PubChem (CID 135311631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).