About 7-bromo-2-chloroquinoline;2-methylpropan-2-amine
7-bromo-2-chloroquinoline;2-methylpropan-2-amine (PubChem CID 135311981) has the molecular formula C13H16BrClN2
and a molecular weight of 315.64 g/mol. Its IUPAC name is 7-bromo-2-chloroquinoline;2-methylpropan-2-amine.
Molecular Properties
| Compound Name | 7-bromo-2-chloroquinoline;2-methylpropan-2-amine |
| PubChem CID | 135311981 |
| Molecular Formula | C13H16BrClN2 |
| Molecular Weight | 315.64 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 7-bromo-2-chloroquinoline;2-methylpropan-2-amine |
| SMILES | CC(C)(C)N.Clc1ccc2ccc(Br)cc2n1 |
| InChI | InChI=1S/C9H5BrClN.C4H11N/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-4(2,3)5/h1-5H;5H2,1-3H3 |
| InChIKey | AYKYIICULHVQDN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2-chloroquinoline;2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-chloroquinoline;2-methylpropan-2-amine?
The IUPAC name of 7-bromo-2-chloroquinoline;2-methylpropan-2-amine (CID 135311981) is 7-bromo-2-chloroquinoline;2-methylpropan-2-amine.
What is the SMILES notation for 7-bromo-2-chloroquinoline;2-methylpropan-2-amine?
The canonical SMILES for 7-bromo-2-chloroquinoline;2-methylpropan-2-amine is CC(C)(C)N.Clc1ccc2ccc(Br)cc2n1.
What is the InChIKey of 7-bromo-2-chloroquinoline;2-methylpropan-2-amine?
The InChIKey is AYKYIICULHVQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrClN.C4H11N/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-4(2,3)5/h1-5H;5H2,1-3H3.
What are the key properties of 7-bromo-2-chloroquinoline;2-methylpropan-2-amine?
7-bromo-2-chloroquinoline;2-methylpropan-2-amine has a molecular weight of 315.64 g/mol, XLogP of 4.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-chloroquinoline;2-methylpropan-2-amine is sourced from PubChem (CID 135311981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).