C24H25Cl2NO6 — CID 135312082
4-[1-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylcarbamoyl]oxyethoxy]-4-oxobutanoic acid (PubChem CID 135312082) has the molecular formula C24H25Cl2NO6 and a molecular weight of 494.37 g/mol. Its IUPAC name is 4-[1-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylcarbamoyl]oxyethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[1-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylcarbamoyl]oxyethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 135312082 |
| Molecular Formula | C24H25Cl2NO6 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 4-[1-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylcarbamoyl]oxyethoxy]-4-oxobutanoic acid |
| SMILES | CC(OC(=O)CCC(=O)O)OC(=O)N(C)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C24H25Cl2NO6/c1-14(32-23(30)12-11-22(28)29)33-24(31)27(2)21-10-8-16(17-5-3-4-6-18(17)21)15-7-9-19(25)20(26)13-15/h3-7,9,13-14,16,21H,8,10-12H2,1-2H3,(H,28,29)/t14?,16-,21-/m0/s1 |
| InChIKey | YPNSAYZDJLSRLM-SVPPLLGISA-N |
| XLogP | 5.78 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|