C25H32FN3O3 — CID 135312521
2-(2-ethyl-4-fluorophenyl)-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]azetidin-1-yl]acetic acid (PubChem CID 135312521) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-(2-ethyl-4-fluorophenyl)-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]azetidin-1-yl]acetic acid.
| Compound Name | 2-(2-ethyl-4-fluorophenyl)-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 135312521 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-(2-ethyl-4-fluorophenyl)-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]azetidin-1-yl]acetic acid |
| SMILES | CCc1cc(F)ccc1C(C(=O)O)N1CC(OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C25H32FN3O3/c1-2-17-14-19(26)9-11-22(17)23(25(30)31)29-15-21(16-29)32-13-4-3-7-20-10-8-18-6-5-12-27-24(18)28-20/h8-11,14,21,23H,2-7,12-13,15-16H2,1H3,(H,27,28)(H,30,31) |
| InChIKey | VRCBWNDFXNEYNR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|