C21H32N2O8 — CID 135312529
2-[2,2-dimethoxyethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]amino]acetic acid (PubChem CID 135312529) has the molecular formula C21H32N2O8 and a molecular weight of 440.49 g/mol. Its IUPAC name is 2-[2,2-dimethoxyethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]amino]acetic acid.
| Compound Name | 2-[2,2-dimethoxyethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 135312529 |
| Molecular Formula | C21H32N2O8 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[2,2-dimethoxyethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]amino]acetic acid |
| SMILES | COC(CN(CC(=O)O)C(=O)C(COCc1ccccc1)NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C21H32N2O8/c1-21(2,3)31-20(27)22-16(14-30-13-15-9-7-6-8-10-15)19(26)23(11-17(24)25)12-18(28-4)29-5/h6-10,16,18H,11-14H2,1-5H3,(H,22,27)(H,24,25) |
| InChIKey | XDQYWANDWIYFSO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|