C15H17F3N4O4S — CID 135312681
4,6-dimethoxy-N-[5-(3-methoxypropyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrimidine-5-carboxamide (PubChem CID 135312681) has the molecular formula C15H17F3N4O4S and a molecular weight of 406.39 g/mol. Its IUPAC name is 4,6-dimethoxy-N-[5-(3-methoxypropyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrimidine-5-carboxamide.
| Compound Name | 4,6-dimethoxy-N-[5-(3-methoxypropyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135312681 |
| Molecular Formula | C15H17F3N4O4S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4,6-dimethoxy-N-[5-(3-methoxypropyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrimidine-5-carboxamide |
| SMILES | COCCCc1sc(NC(=O)c2c(OC)ncnc2OC)nc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N4O4S/c1-24-6-4-5-8-10(15(16,17)18)21-14(27-8)22-11(23)9-12(25-2)19-7-20-13(9)26-3/h7H,4-6H2,1-3H3,(H,21,22,23) |
| InChIKey | CGZZNMBDRJOAPA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|