About 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline
8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline (PubChem CID 135313169) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline.
Molecular Properties
| Compound Name | 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline |
| PubChem CID | 135313169 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline |
| SMILES | c1ncc2ccc3c(c2n1)OCCO3 |
| InChI | InChI=1S/C10H8N2O2/c1-2-8-10(14-4-3-13-8)9-7(1)5-11-6-12-9/h1-2,5-6H,3-4H2 |
| InChIKey | SRWQYSIZWHHCIS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline?
The IUPAC name of 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline (CID 135313169) is 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline.
What is the SMILES notation for 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline?
The canonical SMILES for 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline is c1ncc2ccc3c(c2n1)OCCO3.
What is the InChIKey of 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline?
The InChIKey is SRWQYSIZWHHCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-2-8-10(14-4-3-13-8)9-7(1)5-11-6-12-9/h1-2,5-6H,3-4H2.
What are the key properties of 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline?
8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline has a molecular weight of 188.19 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-[1,4]dioxino[2,3-h]quinazoline is sourced from PubChem (CID 135313169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).