C21H12F4N2O2 — CID 135313448
2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-benzimidazole-4-carboxylic acid (PubChem CID 135313448) has the molecular formula C21H12F4N2O2 and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135313448 |
| Molecular Formula | C21H12F4N2O2 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1nc2c(C(=O)O)cc(-c3c(F)c(F)c(-c4ccccc4)c(F)c3F)cc2[nH]1 |
| InChI | InChI=1S/C21H12F4N2O2/c1-9-26-13-8-11(7-12(21(28)29)20(13)27-9)15-18(24)16(22)14(17(23)19(15)25)10-5-3-2-4-6-10/h2-8H,1H3,(H,26,27)(H,28,29) |
| InChIKey | HNOVWEWVRXDXCS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|