C35H46N4 — CID 135313618
(8S)-N-[[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 135313618) has the molecular formula C35H46N4 and a molecular weight of 522.78 g/mol. Its IUPAC name is (8S)-N-[[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 135313618 |
| Molecular Formula | C35H46N4 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | (8S)-N-[[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CC1(C)CCC(NCc2ccc(CN(C[C@H]3Cc4ccccc4CN3)[C@H]3CCCc4cccnc43)cc2)CC1 |
| InChI | InChI=1S/C35H46N4/c1-35(2)18-16-31(17-19-35)37-22-26-12-14-27(15-13-26)24-39(33-11-5-9-28-10-6-20-36-34(28)33)25-32-21-29-7-3-4-8-30(29)23-38-32/h3-4,6-8,10,12-15,20,31-33,37-38H,5,9,11,16-19,21-25H2,1-2H3/t32-,33+/m1/s1 |
| InChIKey | LBNCYBAXRNMAKW-SAIUNTKASA-N |
| XLogP | 6.73 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |