About 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid
6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid (PubChem CID 135313634) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid |
| PubChem CID | 135313634 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1nc2c(C(=O)O)cc(-c3ccc(-n4c(C)ccc4C)cc3)cc2[nH]1 |
| InChI | InChI=1S/C21H19N3O2/c1-12-4-5-13(2)24(12)17-8-6-15(7-9-17)16-10-18(21(25)26)20-19(11-16)22-14(3)23-20/h4-11H,1-3H3,(H,22,23)(H,25,26) |
| InChIKey | FFEWZJDIIOWZHG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid?
The IUPAC name of 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid (CID 135313634) is 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid.
What is the SMILES notation for 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid?
The canonical SMILES for 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid is Cc1nc2c(C(=O)O)cc(-c3ccc(-n4c(C)ccc4C)cc3)cc2[nH]1.
What is the InChIKey of 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid?
The InChIKey is FFEWZJDIIOWZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c1-12-4-5-13(2)24(12)17-8-6-15(7-9-17)16-10-18(21(25)26)20-19(11-16)22-14(3)23-20/h4-11H,1-3H3,(H,22,23)(H,25,26).
What are the key properties of 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid?
6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid has a molecular weight of 345.40 g/mol, XLogP of 4.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid is sourced from PubChem (CID 135313634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).