C33H37N5 — CID 135313715
(8S)-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 135313715) has the molecular formula C33H37N5 and a molecular weight of 503.69 g/mol. Its IUPAC name is (8S)-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 135313715 |
| Molecular Formula | C33H37N5 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | (8S)-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | c1ccc(CNCc2ccc(CN(C[C@H]3Cc4ccccc4CN3)[C@H]3CCCc4cccnc43)cc2)nc1 |
| InChI | InChI=1S/C33H37N5/c1-2-8-29-21-37-31(19-28(29)7-1)24-38(32-12-5-9-27-10-6-18-36-33(27)32)23-26-15-13-25(14-16-26)20-34-22-30-11-3-4-17-35-30/h1-4,6-8,10-11,13-18,31-32,34,37H,5,9,12,19-24H2/t31-,32+/m1/s1 |
| InChIKey | SIMHCJVBDXBOGC-ZWXJPIIXSA-N |
| XLogP | 5.36 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |