About 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane]
7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] (PubChem CID 135313944) has the molecular formula C16H20ClNO2
and a molecular weight of 293.79 g/mol. Its IUPAC name is 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane].
Molecular Properties
| Compound Name | 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] |
| PubChem CID | 135313944 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] |
| SMILES | COCCCOc1cc2c(cc1Cl)C=NC1(CCC1)C2 |
| InChI | InChI=1S/C16H20ClNO2/c1-19-6-3-7-20-15-9-12-10-16(4-2-5-16)18-11-13(12)8-14(15)17/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | IWHJNKKVPNJMHC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane]?
The IUPAC name of 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] (CID 135313944) is 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane].
What is the SMILES notation for 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane]?
The canonical SMILES for 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] is COCCCOc1cc2c(cc1Cl)C=NC1(CCC1)C2.
What is the InChIKey of 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane]?
The InChIKey is IWHJNKKVPNJMHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClNO2/c1-19-6-3-7-20-15-9-12-10-16(4-2-5-16)18-11-13(12)8-14(15)17/h8-9,11H,2-7,10H2,1H3.
What are the key properties of 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane]?
7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] has a molecular weight of 293.79 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-6-(3-methoxypropoxy)spiro[4H-isoquinoline-3,1'-cyclobutane] is sourced from PubChem (CID 135313944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).