C22H32N4 — CID 135314135
N'-[(1S)-1-(5-methyl-2-pyridinyl)ethyl]-N'-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)butane-1,4-diamine (PubChem CID 135314135) has the molecular formula C22H32N4 and a molecular weight of 352.53 g/mol. Its IUPAC name is N'-[(1S)-1-(5-methyl-2-pyridinyl)ethyl]-N'-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)butane-1,4-diamine.
| Compound Name | N'-[(1S)-1-(5-methyl-2-pyridinyl)ethyl]-N'-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 135314135 |
| Molecular Formula | C22H32N4 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | N'-[(1S)-1-(5-methyl-2-pyridinyl)ethyl]-N'-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)butane-1,4-diamine |
| SMILES | Cc1ccc([C@H](C)N(CCCCN)CC2Cc3ccccc3CN2)nc1 |
| InChI | InChI=1S/C22H32N4/c1-17-9-10-22(25-14-17)18(2)26(12-6-5-11-23)16-21-13-19-7-3-4-8-20(19)15-24-21/h3-4,7-10,14,18,21,24H,5-6,11-13,15-16,23H2,1-2H3/t18-,21?/m0/s1 |
| InChIKey | VDVDBVDCSZIDCF-YMXDCFFPSA-N |
| XLogP | 3.21 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|