C18H26N4S — CID 135314316
N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-4-ylmethyl)butane-1,4-diamine (PubChem CID 135314316) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-4-ylmethyl)butane-1,4-diamine.
| Compound Name | N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-4-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 135314316 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-4-ylmethyl)butane-1,4-diamine |
| SMILES | C1[C@@H](NCC2=CC=CC=C21)CN(CCCCN)CC3=CSC=N3 |
| InChI | InChI=1S/C18H26N4S/c19-7-3-4-8-22(12-18-13-23-14-21-18)11-17-9-15-5-1-2-6-16(15)10-20-17/h1-2,5-6,13-14,17,20H,3-4,7-12,19H2/t17-/m1/s1 |
| InChIKey | LCSXPBKNDYNSBO-QGZVFWFLSA-N |
| XLogP | 1.80 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | 341 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|