About 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole
7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole (PubChem CID 135314461) has the molecular formula C22H14N4O
and a molecular weight of 350.38 g/mol. Its IUPAC name is 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole |
| PubChem CID | 135314461 |
| Molecular Formula | C22H14N4O |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole |
| SMILES | c1cc2c(cn1)[nH]c1cc(Oc3ccc4c(c3)[nH]c3cnccc34)ccc12 |
| InChI | InChI=1S/C22H14N4O/c1-3-15-17-5-7-23-11-21(17)25-19(15)9-13(1)27-14-2-4-16-18-6-8-24-12-22(18)26-20(16)10-14/h1-12,25-26H |
| InChIKey | RHFMAXUEASILCU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole?
The IUPAC name of 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole (CID 135314461) is 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole?
The canonical SMILES for 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole is c1cc2c(cn1)[nH]c1cc(Oc3ccc4c(c3)[nH]c3cnccc34)ccc12.
What is the InChIKey of 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole?
The InChIKey is RHFMAXUEASILCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N4O/c1-3-15-17-5-7-23-11-21(17)25-19(15)9-13(1)27-14-2-4-16-18-6-8-24-12-22(18)26-20(16)10-14/h1-12,25-26H.
What are the key properties of 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole?
7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole has a molecular weight of 350.38 g/mol, XLogP of 5.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(9H-pyrido[3,4-b]indol-7-yloxy)-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 135314461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).