C18H26N4S — CID 135314474
N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine (PubChem CID 135314474) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine.
| Compound Name | N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 135314474 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine |
| SMILES | NCCCCN(Cc1nccs1)C[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C18H26N4S/c19-7-3-4-9-22(14-18-20-8-10-23-18)13-17-11-15-5-1-2-6-16(15)12-21-17/h1-2,5-6,8,10,17,21H,3-4,7,9,11-14,19H2/t17-/m1/s1 |
| InChIKey | ZQHOKHZODTUMSC-QGZVFWFLSA-N |
| XLogP | 2.40 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|