About 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine
6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine (PubChem CID 135314476) has the molecular formula C8H9BrN2
and a molecular weight of 213.08 g/mol. Its IUPAC name is 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine |
| PubChem CID | 135314476 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine |
| SMILES | CN1C=CC2N=CC(Br)=CC21 |
| InChI | InChI=1S/C8H9BrN2/c1-11-3-2-7-8(11)4-6(9)5-10-7/h2-5,7-8H,1H3 |
| InChIKey | UKHXQLLARVMWFF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine?
The IUPAC name of 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine (CID 135314476) is 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine.
What is the SMILES notation for 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine?
The canonical SMILES for 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine is CN1C=CC2N=CC(Br)=CC21.
What is the InChIKey of 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine?
The InChIKey is UKHXQLLARVMWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2/c1-11-3-2-7-8(11)4-6(9)5-10-7/h2-5,7-8H,1H3.
What are the key properties of 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine?
6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine has a molecular weight of 213.08 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridine is sourced from PubChem (CID 135314476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).