C24H26N2O4S — CID 135314514
(4R,7R,7aR,12bS)-3-(benzenesulfonyl)-9-methoxy-N-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine (PubChem CID 135314514) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is (4R,7R,7aR,12bS)-3-(benzenesulfonyl)-9-methoxy-N-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine.
| Compound Name | (4R,7R,7aR,12bS)-3-(benzenesulfonyl)-9-methoxy-N-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine |
|---|---|
| PubChem CID | 135314514 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (4R,7R,7aR,12bS)-3-(benzenesulfonyl)-9-methoxy-N-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine |
| SMILES | CN[C@@H]1CC=C2[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3S(=O)(=O)c2ccccc2)[C@H]1O5 |
| InChI | InChI=1S/C24H26N2O4S/c1-25-18-10-9-17-19-14-15-8-11-20(29-2)22-21(15)24(17,23(18)30-22)12-13-26(19)31(27,28)16-6-4-3-5-7-16/h3-9,11,18-19,23,25H,10,12-14H2,1-2H3/t18-,19-,23+,24+/m1/s1 |
| InChIKey | IJIUOYYKULHKAI-VSQYNUGQSA-N |
| XLogP | 2.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|