About [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride
[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride (PubChem CID 135315605) has the molecular formula C13H18ClN3O5
and a molecular weight of 331.76 g/mol. Its IUPAC name is [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride.
Molecular Properties
| Compound Name | [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride |
| PubChem CID | 135315605 |
| Molecular Formula | C13H18ClN3O5 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride |
| SMILES | Cl.O=C(O)NNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C13H17N3O5.ClH/c17-10-5-6-11(18)16(10)7-8-1-3-9(4-2-8)12(19)14-15-13(20)21;/h5-6,8-9,15H,1-4,7H2,(H,14,19)(H,20,21);1H |
| InChIKey | SDMLHKIJEBAIGT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride?
The IUPAC name of [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride (CID 135315605) is [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride.
What is the SMILES notation for [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride?
The canonical SMILES for [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride is Cl.O=C(O)NNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1.
What is the InChIKey of [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride?
The InChIKey is SDMLHKIJEBAIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O5.ClH/c17-10-5-6-11(18)16(10)7-8-1-3-9(4-2-8)12(19)14-15-13(20)21;/h5-6,8-9,15H,1-4,7H2,(H,14,19)(H,20,21);1H.
What are the key properties of [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride?
[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride has a molecular weight of 331.76 g/mol, XLogP of 0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamic acid;hydrochloride is sourced from PubChem (CID 135315605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).