C21H21F3N2O7S — CID 135316202
(6R)-10-(methoxymethyl)-3,3-dimethyl-15-oxo-9-(trifluoromethylsulfonyloxy)-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid (PubChem CID 135316202) has the molecular formula C21H21F3N2O7S and a molecular weight of 502.47 g/mol. Its IUPAC name is (6R)-10-(methoxymethyl)-3,3-dimethyl-15-oxo-9-(trifluoromethylsulfonyloxy)-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid.
| Compound Name | (6R)-10-(methoxymethyl)-3,3-dimethyl-15-oxo-9-(trifluoromethylsulfonyloxy)-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid |
|---|---|
| PubChem CID | 135316202 |
| Molecular Formula | C21H21F3N2O7S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (6R)-10-(methoxymethyl)-3,3-dimethyl-15-oxo-9-(trifluoromethylsulfonyloxy)-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid |
| SMILES | COCc1cc2c(cc1OS(=O)(=O)C(F)(F)F)[C@H]1CCC(C)(C)N1n1cc(C(=O)O)c(=O)cc1-2 |
| InChI | InChI=1S/C21H21F3N2O7S/c1-20(2)5-4-15-13-7-18(33-34(30,31)21(22,23)24)11(10-32-3)6-12(13)16-8-17(27)14(19(28)29)9-25(16)26(15)20/h6-9,15H,4-5,10H2,1-3H3,(H,28,29)/t15-/m1/s1 |
| InChIKey | PPDZWRIOCGINQC-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|