About methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate
methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate (PubChem CID 135316811) has the molecular formula C9H6F3NO4S
and a molecular weight of 281.21 g/mol. Its IUPAC name is methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate.
Molecular Properties
| Compound Name | methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate |
| PubChem CID | 135316811 |
| Molecular Formula | C9H6F3NO4S |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H6F3NO4S/c1-17-7(16)5(15)2-4(14)6-3-13-8(18-6)9(10,11)12/h3H,2H2,1H3 |
| InChIKey | QMSANHPVFTUMLE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate?
The IUPAC name of methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate (CID 135316811) is methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate.
What is the SMILES notation for methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate?
The canonical SMILES for methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate is COC(=O)C(=O)CC(=O)c1cnc(C(F)(F)F)s1.
What is the InChIKey of methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate?
The InChIKey is QMSANHPVFTUMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3NO4S/c1-17-7(16)5(15)2-4(14)6-3-13-8(18-6)9(10,11)12/h3H,2H2,1H3.
What are the key properties of methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate?
methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate has a molecular weight of 281.21 g/mol, XLogP of 1.48, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dioxo-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate is sourced from PubChem (CID 135316811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).