C19H18F3N5O3S2 — CID 135317441
(3R,5S)-2-methyl-5-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317441) has the molecular formula C19H18F3N5O3S2 and a molecular weight of 485.51 g/mol. Its IUPAC name is (3R,5S)-2-methyl-5-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-2-methyl-5-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317441 |
| Molecular Formula | C19H18F3N5O3S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (3R,5S)-2-methyl-5-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@@H](C(=O)Nc2cc(F)c(F)c(F)c2)C[C@@H](c2ccc(-c3cnn(C)c3)s2)NS1(=O)=O |
| InChI | InChI=1S/C19H18F3N5O3S2/c1-26-9-10(8-23-26)16-3-4-17(31-16)14-7-15(27(2)32(29,30)25-14)19(28)24-11-5-12(20)18(22)13(21)6-11/h3-6,8-9,14-15,25H,7H2,1-2H3,(H,24,28)/t14-,15+/m0/s1 |
| InChIKey | KRUOZASRVWZTFW-LSDHHAIUSA-N |
| XLogP | 2.78 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|