C14H14ClFN4O3S2 — CID 135317606
(3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(1,2-thiazol-5-yl)-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317606) has the molecular formula C14H14ClFN4O3S2 and a molecular weight of 404.88 g/mol. Its IUPAC name is (3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(1,2-thiazol-5-yl)-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(1,2-thiazol-5-yl)-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317606 |
| Molecular Formula | C14H14ClFN4O3S2 |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (3R,5S)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(1,2-thiazol-5-yl)-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@@H](c2ccns2)NS1(=O)=O |
| InChI | InChI=1S/C14H14ClFN4O3S2/c1-20-12(14(21)18-8-2-3-10(16)9(15)6-8)7-11(19-25(20,22)23)13-4-5-17-24-13/h2-6,11-12,19H,7H2,1H3,(H,18,21)/t11-,12+/m0/s1 |
| InChIKey | XLNIUMRWGRFHAB-NWDGAFQWSA-N |
| XLogP | 2.15 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |