About US11084800, Cpd No. 484
US11084800, Cpd No. 484 (PubChem CID 135317841) has the molecular formula C33H31BrFN9O4
and a molecular weight of 716.60 g/mol. Its IUPAC name is (1R,3S,5R)-2-[2-[3-acetyl-7-methyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-N-(6-bromo-5-fluoro-3-methyl-2-pyridinyl)-5-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
Molecular Properties
| Compound Name | US11084800, Cpd No. 484 |
| PubChem CID | 135317841 |
| Molecular Formula | C33H31BrFN9O4 |
| Molecular Weight | 716.60 g/mol |
| Exact Mass | 715.17 |
| IUPAC Name | (1R,3S,5R)-2-[2-[3-acetyl-7-methyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-N-(6-bromo-5-fluoro-3-methyl-2-pyridinyl)-5-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CC1=CC(=CC2=C1N(N=C2C(=O)C)CC(=O)N3[C@@H](C[C@@]4([C@H]3C4)CC5=NN=C(O5)C)C(=O)NC6=NC(=C(C=C6C)F)Br)C7=CN=C(N=C7)C |
| InChI | InChI=1S/C33H31BrFN9O4/c1-15-6-20(21-12-36-18(4)37-13-21)8-22-28(17(3)45)42-43(29(15)22)14-27(46)44-24(32(47)39-31-16(2)7-23(35)30(34)38-31)9-33(10-25(33)44)11-26-41-40-19(5)48-26/h6-8,12-13,24-25H,9-11,14H2,1-5H3,(H,38,39,47)/t24-,25+,33-/m0/s1 |
| InChIKey | OECXNKXLMDGFQV-DVIHYUSWSA-N |
| XLogP | 4.20 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | 1250 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 716.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze US11084800, Cpd No. 484 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US11084800, Cpd No. 484?
The IUPAC name of US11084800, Cpd No. 484 (CID 135317841) is (1R,3S,5R)-2-[2-[3-acetyl-7-methyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-N-(6-bromo-5-fluoro-3-methyl-2-pyridinyl)-5-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
What is the SMILES notation for US11084800, Cpd No. 484?
The canonical SMILES for US11084800, Cpd No. 484 is CC1=CC(=CC2=C1N(N=C2C(=O)C)CC(=O)N3[C@@H](C[C@@]4([C@H]3C4)CC5=NN=C(O5)C)C(=O)NC6=NC(=C(C=C6C)F)Br)C7=CN=C(N=C7)C.
What is the InChIKey of US11084800, Cpd No. 484?
The InChIKey is OECXNKXLMDGFQV-DVIHYUSWSA-N. The full InChI is InChI=1S/C33H31BrFN9O4/c1-15-6-20(21-12-36-18(4)37-13-21)8-22-28(17(3)45)42-43(29(15)22)14-27(46)44-24(32(47)39-31-16(2)7-23(35)30(34)38-31)9-33(10-25(33)44)11-26-41-40-19(5)48-26/h6-8,12-13,24-25H,9-11,14H2,1-5H3,(H,38,39,47)/t24-,25+,33-/m0/s1.
What are the key properties of US11084800, Cpd No. 484?
US11084800, Cpd No. 484 has a molecular weight of 716.60 g/mol, XLogP of 4.20, 8 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for US11084800, Cpd No. 484 is sourced from PubChem (CID 135317841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).