C26H30BrN5O6 — CID 135318529
ethyl 3-acetyl-1-[2-[(1R,3S,5R)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-methyl-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]pyrazole-5-carboxylate (PubChem CID 135318529) has the molecular formula C26H30BrN5O6 and a molecular weight of 588.46 g/mol. Its IUPAC name is ethyl 3-acetyl-1-[2-[(1R,3S,5R)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-methyl-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]pyrazole-5-carboxylate.
| Compound Name | ethyl 3-acetyl-1-[2-[(1R,3S,5R)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-methyl-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135318529 |
| Molecular Formula | C26H30BrN5O6 |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | ethyl 3-acetyl-1-[2-[(1R,3S,5R)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-methyl-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]pyrazole-5-carboxylate |
| SMILES | C=CCOCc1ccc(Br)nc1NC(=O)[C@@H]1C[C@@]2(C)C[C@H]2N1C(=O)Cn1nc(C(C)=O)cc1C(=O)OCC |
| InChI | InChI=1S/C26H30BrN5O6/c1-5-9-37-14-16-7-8-21(27)28-23(16)29-24(35)19-11-26(4)12-20(26)32(19)22(34)13-31-18(25(36)38-6-2)10-17(30-31)15(3)33/h5,7-8,10,19-20H,1,6,9,11-14H2,2-4H3,(H,28,29,35)/t19-,20+,26-/m0/s1 |
| InChIKey | LAVNIAKRXGFXTC-UNVFRBQDSA-N |
| XLogP | 3.14 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|