C11H12N4O2 — CID 135319051
ethyl 3-(2-methylpyrimidin-5-yl)-1H-pyrazole-5-carboxylate (PubChem CID 135319051) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is ethyl 3-(2-methylpyrimidin-5-yl)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(2-methylpyrimidin-5-yl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135319051 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | ethyl 3-(2-methylpyrimidin-5-yl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cnc(C)nc2)n[nH]1 |
| InChI | InChI=1S/C11H12N4O2/c1-3-17-11(16)10-4-9(14-15-10)8-5-12-7(2)13-6-8/h4-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | SBMFTPQTUDQNAI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |