About tert-butyl prop-2-enoate;cyclohexanol
tert-butyl prop-2-enoate;cyclohexanol (PubChem CID 135319447) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;cyclohexanol.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;cyclohexanol |
| PubChem CID | 135319447 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | tert-butyl prop-2-enoate;cyclohexanol |
| SMILES | C=CC(=O)OC(C)(C)C.OC1CCCCC1 |
| InChI | InChI=1S/C7H12O2.C6H12O/c1-5-6(8)9-7(2,3)4;7-6-4-2-1-3-5-6/h5H,1H2,2-4H3;6-7H,1-5H2 |
| InChIKey | QTTQYMHLHJIQGX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;cyclohexanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;cyclohexanol?
The IUPAC name of tert-butyl prop-2-enoate;cyclohexanol (CID 135319447) is tert-butyl prop-2-enoate;cyclohexanol.
What is the SMILES notation for tert-butyl prop-2-enoate;cyclohexanol?
The canonical SMILES for tert-butyl prop-2-enoate;cyclohexanol is C=CC(=O)OC(C)(C)C.OC1CCCCC1.
What is the InChIKey of tert-butyl prop-2-enoate;cyclohexanol?
The InChIKey is QTTQYMHLHJIQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C6H12O/c1-5-6(8)9-7(2,3)4;7-6-4-2-1-3-5-6/h5H,1H2,2-4H3;6-7H,1-5H2.
What are the key properties of tert-butyl prop-2-enoate;cyclohexanol?
tert-butyl prop-2-enoate;cyclohexanol has a molecular weight of 228.33 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;cyclohexanol is sourced from PubChem (CID 135319447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).