About 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid
7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid (PubChem CID 135319468) has the molecular formula C10H10N2O2S2
and a molecular weight of 254.34 g/mol. Its IUPAC name is 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid.
Molecular Properties
| Compound Name | 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid |
| PubChem CID | 135319468 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid |
| SMILES | CCc1c(C(=O)O)cnc2nc(SC)sc12 |
| InChI | InChI=1S/C10H10N2O2S2/c1-3-5-6(9(13)14)4-11-8-7(5)16-10(12-8)15-2/h4H,3H2,1-2H3,(H,13,14) |
| InChIKey | MFFZSUFJNCUBDO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid?
The IUPAC name of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid (CID 135319468) is 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid.
What is the SMILES notation for 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid?
The canonical SMILES for 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid is CCc1c(C(=O)O)cnc2nc(SC)sc12.
What is the InChIKey of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid?
The InChIKey is MFFZSUFJNCUBDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S2/c1-3-5-6(9(13)14)4-11-8-7(5)16-10(12-8)15-2/h4H,3H2,1-2H3,(H,13,14).
What are the key properties of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid?
7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid has a molecular weight of 254.34 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid is sourced from PubChem (CID 135319468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).