About ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate
ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate (PubChem CID 135319669) has the molecular formula C12H14N2O2S2
and a molecular weight of 282.39 g/mol. Its IUPAC name is ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate |
| PubChem CID | 135319669 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2nc(SC)sc2c1CC |
| InChI | InChI=1S/C12H14N2O2S2/c1-4-7-8(11(15)16-5-2)6-13-10-9(7)18-12(14-10)17-3/h6H,4-5H2,1-3H3 |
| InChIKey | SSHZRTPFIRCLFO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate?
The IUPAC name of ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate (CID 135319669) is ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate.
What is the SMILES notation for ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate?
The canonical SMILES for ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate is CCOC(=O)c1cnc2nc(SC)sc2c1CC.
What is the InChIKey of ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate?
The InChIKey is SSHZRTPFIRCLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S2/c1-4-7-8(11(15)16-5-2)6-13-10-9(7)18-12(14-10)17-3/h6H,4-5H2,1-3H3.
What are the key properties of ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate?
ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate has a molecular weight of 282.39 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate is sourced from PubChem (CID 135319669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).