About 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine
7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine (PubChem CID 135319692) has the molecular formula C9H11N3S2
and a molecular weight of 225.34 g/mol. Its IUPAC name is 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine |
| PubChem CID | 135319692 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine |
| SMILES | CCc1c(N)cnc2nc(SC)sc12 |
| InChI | InChI=1S/C9H11N3S2/c1-3-5-6(10)4-11-8-7(5)14-9(12-8)13-2/h4H,3,10H2,1-2H3 |
| InChIKey | ZQGHCKSUTBJUHS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
The IUPAC name of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine (CID 135319692) is 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
The canonical SMILES for 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine is CCc1c(N)cnc2nc(SC)sc12.
What is the InChIKey of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
The InChIKey is ZQGHCKSUTBJUHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S2/c1-3-5-6(10)4-11-8-7(5)14-9(12-8)13-2/h4H,3,10H2,1-2H3.
What are the key properties of 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine?
7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine has a molecular weight of 225.34 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 135319692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).