C22H20N2O3S — CID 135320520
N-hydroxy-2-phenyl-2-[3-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide (PubChem CID 135320520) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-hydroxy-2-phenyl-2-[3-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide.
| Compound Name | N-hydroxy-2-phenyl-2-[3-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 135320520 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-hydroxy-2-phenyl-2-[3-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide |
| SMILES | O=C(CSc1ccccc1)Nc1cccc(C(C(=O)NO)c2ccccc2)c1 |
| InChI | InChI=1S/C22H20N2O3S/c25-20(15-28-19-12-5-2-6-13-19)23-18-11-7-10-17(14-18)21(22(26)24-27)16-8-3-1-4-9-16/h1-14,21,27H,15H2,(H,23,25)(H,24,26) |
| InChIKey | QKGULKADVGTRDS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|