About (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate
(5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 135320749) has the molecular formula C18H16ClF4N3O2
and a molecular weight of 417.79 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| PubChem CID | 135320749 |
| Molecular Formula | C18H16ClF4N3O2 |
| Molecular Weight | 417.79 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | O=C(Oc1cncc(F)c1)N1CCN(Cc2cc(Cl)ccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H16ClF4N3O2/c19-13-1-2-16(18(21,22)23)12(7-13)11-25-3-5-26(6-4-25)17(27)28-15-8-14(20)9-24-10-15/h1-2,7-10H,3-6,11H2 |
| InChIKey | QETDNWXELKMAQP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate?
The IUPAC name of (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (CID 135320749) is (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
What is the SMILES notation for (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate?
The canonical SMILES for (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate is O=C(Oc1cncc(F)c1)N1CCN(Cc2cc(Cl)ccc2C(F)(F)F)CC1.
What is the InChIKey of (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate?
The InChIKey is QETDNWXELKMAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF4N3O2/c19-13-1-2-16(18(21,22)23)12(7-13)11-25-3-5-26(6-4-25)17(27)28-15-8-14(20)9-24-10-15/h1-2,7-10H,3-6,11H2.
What are the key properties of (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate?
(5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate has a molecular weight of 417.79 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-3-pyridinyl) 4-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate is sourced from PubChem (CID 135320749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).