C11H19F3N2O3 — CID 135320990
(2-amino-4,4-difluoro-3-methylbutanoyl) (2R,3R)-2-amino-3-fluoro-3-methylpentanoate (PubChem CID 135320990) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is (2-amino-4,4-difluoro-3-methylbutanoyl) (2R,3R)-2-amino-3-fluoro-3-methylpentanoate.
| Compound Name | (2-amino-4,4-difluoro-3-methylbutanoyl) (2R,3R)-2-amino-3-fluoro-3-methylpentanoate |
|---|---|
| PubChem CID | 135320990 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2-amino-4,4-difluoro-3-methylbutanoyl) (2R,3R)-2-amino-3-fluoro-3-methylpentanoate |
| SMILES | CC[C@@](C)(F)[C@H](N)C(=O)OC(=O)C(N)C(C)C(F)F |
| InChI | InChI=1S/C11H19F3N2O3/c1-4-11(3,14)7(16)10(18)19-9(17)6(15)5(2)8(12)13/h5-8H,4,15-16H2,1-3H3/t5?,6?,7-,11-/m1/s1 |
| InChIKey | NXAQMOFSKSBHMB-LRIQFXKISA-N |
| XLogP | 0.75 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|