C63H70F8O2 — CID 135321331
2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropentyl)fluorene (PubChem CID 135321331) has the molecular formula C63H70F8O2 and a molecular weight of 1011.23 g/mol. Its IUPAC name is 2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropentyl)fluorene.
| Compound Name | 2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropentyl)fluorene |
|---|---|
| PubChem CID | 135321331 |
| Molecular Formula | C63H70F8O2 |
| Molecular Weight | 1011.23 g/mol |
| Exact Mass | 1010.52 |
| IUPAC Name | 2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropentyl)fluorene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C(C(F)(F)C(F)(F)CCC)(C(F)(F)C(F)(F)CCC)c3cc(-c5ccc(-c6ccc(OCCCCCCCC)cc6)cc5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C63H70F8O2/c1-5-9-11-13-15-17-41-72-53-33-27-47(28-34-53)45-19-23-49(24-20-45)51-31-37-55-56-38-32-52(50-25-21-46(22-26-50)48-29-35-54(36-30-48)73-42-18-16-14-12-10-6-2)44-58(56)61(57(55)43-51,62(68,69)59(64,65)39-7-3)63(70,71)60(66,67)40-8-4/h19-38,43-44H,5-18,39-42H2,1-4H3 |
| InChIKey | ICDLVWOUZAXZLX-UHFFFAOYSA-N |
| XLogP | 20.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.23 |
| LogP ≤ 5 | 20.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|