C24H33N3O2 — CID 135322566
[4-[[4-(ethoxymethyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]urea (PubChem CID 135322566) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is [4-[[4-(ethoxymethyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]urea.
| Compound Name | [4-[[4-(ethoxymethyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 135322566 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | [4-[[4-(ethoxymethyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]urea |
| SMILES | CCOCC1(CCc2ccccc2)CCN(Cc2ccc(NC(N)=O)cc2)CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-2-29-19-24(13-12-20-6-4-3-5-7-20)14-16-27(17-15-24)18-21-8-10-22(11-9-21)26-23(25)28/h3-11H,2,12-19H2,1H3,(H3,25,26,28) |
| InChIKey | HIRUMKHJSMYORF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |