C20H32N2O3 — CID 135323316
tert-butyl (3S)-3-(ethoxymethyl)-3-[(N-methylanilino)methyl]pyrrolidine-1-carboxylate (PubChem CID 135323316) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl (3S)-3-(ethoxymethyl)-3-[(N-methylanilino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(ethoxymethyl)-3-[(N-methylanilino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135323316 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl (3S)-3-(ethoxymethyl)-3-[(N-methylanilino)methyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC[C@]1(CN(C)c2ccccc2)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H32N2O3/c1-6-24-16-20(14-21(5)17-10-8-7-9-11-17)12-13-22(15-20)18(23)25-19(2,3)4/h7-11H,6,12-16H2,1-5H3/t20-/m0/s1 |
| InChIKey | MWEPORLJZSDONF-FQEVSTJZSA-N |
| XLogP | 3.79 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |