2,3-dihydroxypropanoic acid;2-hydroxyacetic acid

C5H10O7 — CID 135323776

IUPAC2,3-dihydroxypropanoic acid;2-hydroxyacetic acid
SMILESO=C(O)C(O)CO.O=C(O)CO
InChIInChI=1S/C3H6O4.C2H4O3/c4-1-2(5)3(6)7;3-1-2(4)5/h2,4-5H,1H2,(H,6,7);3H,1H2,(H,4,5)
InChIKeyWIAMTVKLMCQNQF-UHFFFAOYSA-N
MW182.13 g/mol
LogP-2.51
Rot. Bonds3

About 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid

2,3-dihydroxypropanoic acid;2-hydroxyacetic acid (PubChem CID 135323776) has the molecular formula C5H10O7 and a molecular weight of 182.13 g/mol. Its IUPAC name is 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid.

Molecular Properties

Compound Name2,3-dihydroxypropanoic acid;2-hydroxyacetic acid
PubChem CID135323776
Molecular FormulaC5H10O7
Molecular Weight182.13 g/mol
Exact Mass182.04
IUPAC Name2,3-dihydroxypropanoic acid;2-hydroxyacetic acid
SMILESO=C(O)C(O)CO.O=C(O)CO
InChIInChI=1S/C3H6O4.C2H4O3/c4-1-2(5)3(6)7;3-1-2(4)5/h2,4-5H,1H2,(H,6,7);3H,1H2,(H,4,5)
InChIKeyWIAMTVKLMCQNQF-UHFFFAOYSA-N
XLogP-2.51
TPSA135.29 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.13
LogP ≤ 5-2.51
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid?
The IUPAC name of 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid (CID 135323776) is 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid.
What is the SMILES notation for 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid?
The canonical SMILES for 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid is O=C(O)C(O)CO.O=C(O)CO.
What is the InChIKey of 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid?
The InChIKey is WIAMTVKLMCQNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O4.C2H4O3/c4-1-2(5)3(6)7;3-1-2(4)5/h2,4-5H,1H2,(H,6,7);3H,1H2,(H,4,5).
What are the key properties of 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid?
2,3-dihydroxypropanoic acid;2-hydroxyacetic acid has a molecular weight of 182.13 g/mol, XLogP of -2.51, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid is sourced from PubChem (CID 135323776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).