C5H10O7 — CID 135323776
2,3-dihydroxypropanoic acid;2-hydroxyacetic acid (PubChem CID 135323776) has the molecular formula C5H10O7 and a molecular weight of 182.13 g/mol. Its IUPAC name is 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid.
| Compound Name | 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid |
|---|---|
| PubChem CID | 135323776 |
| Molecular Formula | C5H10O7 |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2,3-dihydroxypropanoic acid;2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)CO.O=C(O)CO |
| InChI | InChI=1S/C3H6O4.C2H4O3/c4-1-2(5)3(6)7;3-1-2(4)5/h2,4-5H,1H2,(H,6,7);3H,1H2,(H,4,5) |
| InChIKey | WIAMTVKLMCQNQF-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |