C21H22F3NO11 — CID 135324079
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate (PubChem CID 135324079) has the molecular formula C21H22F3NO11 and a molecular weight of 521.40 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 135324079 |
| Molecular Formula | C21H22F3NO11 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-formamido-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C(F)(F)F)cc2NC=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H22F3NO11/c1-9(27)32-15-16(33-10(2)28)18(34-11(3)29)20(36-17(15)19(30)31-4)35-14-6-5-12(21(22,23)24)7-13(14)25-8-26/h5-8,15-18,20H,1-4H3,(H,25,26)/t15-,16-,17-,18+,20+/m0/s1 |
| InChIKey | IDCNLGKDOJURCW-KVIJGQROSA-N |
| XLogP | 1.35 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|