2-aminoacetic acid;methanesulfonic acid

C3H9NO5S — CID 135324111

IUPAC2-aminoacetic acid;methanesulfonic acid
SMILESCS(=O)(=O)O.NCC(=O)O
InChIInChI=1S/C2H5NO2.CH4O3S/c3-1-2(4)5;1-5(2,3)4/h1,3H2,(H,4,5);1H3,(H,2,3,4)
InChIKeyYWACJRGCEVWOES-UHFFFAOYSA-N
MW171.17 g/mol
LogP-1.47
Rot. Bonds1

About 2-aminoacetic acid;methanesulfonic acid

2-aminoacetic acid;methanesulfonic acid (PubChem CID 135324111) has the molecular formula C3H9NO5S and a molecular weight of 171.17 g/mol. Its IUPAC name is 2-aminoacetic acid;methanesulfonic acid.

Molecular Properties

Compound Name2-aminoacetic acid;methanesulfonic acid
PubChem CID135324111
Molecular FormulaC3H9NO5S
Molecular Weight171.17 g/mol
Exact Mass171.02
IUPAC Name2-aminoacetic acid;methanesulfonic acid
SMILESCS(=O)(=O)O.NCC(=O)O
InChIInChI=1S/C2H5NO2.CH4O3S/c3-1-2(4)5;1-5(2,3)4/h1,3H2,(H,4,5);1H3,(H,2,3,4)
InChIKeyYWACJRGCEVWOES-UHFFFAOYSA-N
XLogP-1.47
TPSA117.69 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.17
LogP ≤ 5-1.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-aminoacetic acid;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoacetic acid;methanesulfonic acid?
The IUPAC name of 2-aminoacetic acid;methanesulfonic acid (CID 135324111) is 2-aminoacetic acid;methanesulfonic acid.
What is the SMILES notation for 2-aminoacetic acid;methanesulfonic acid?
The canonical SMILES for 2-aminoacetic acid;methanesulfonic acid is CS(=O)(=O)O.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;methanesulfonic acid?
The InChIKey is YWACJRGCEVWOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CH4O3S/c3-1-2(4)5;1-5(2,3)4/h1,3H2,(H,4,5);1H3,(H,2,3,4).
What are the key properties of 2-aminoacetic acid;methanesulfonic acid?
2-aminoacetic acid;methanesulfonic acid has a molecular weight of 171.17 g/mol, XLogP of -1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;methanesulfonic acid is sourced from PubChem (CID 135324111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).