About 2-aminoacetic acid;methanesulfonic acid
2-aminoacetic acid;methanesulfonic acid (PubChem CID 135324111) has the molecular formula C3H9NO5S
and a molecular weight of 171.17 g/mol. Its IUPAC name is 2-aminoacetic acid;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-aminoacetic acid;methanesulfonic acid |
| PubChem CID | 135324111 |
| Molecular Formula | C3H9NO5S |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 2-aminoacetic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NCC(=O)O |
| InChI | InChI=1S/C2H5NO2.CH4O3S/c3-1-2(4)5;1-5(2,3)4/h1,3H2,(H,4,5);1H3,(H,2,3,4) |
| InChIKey | YWACJRGCEVWOES-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;methanesulfonic acid?
The IUPAC name of 2-aminoacetic acid;methanesulfonic acid (CID 135324111) is 2-aminoacetic acid;methanesulfonic acid.
What is the SMILES notation for 2-aminoacetic acid;methanesulfonic acid?
The canonical SMILES for 2-aminoacetic acid;methanesulfonic acid is CS(=O)(=O)O.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;methanesulfonic acid?
The InChIKey is YWACJRGCEVWOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CH4O3S/c3-1-2(4)5;1-5(2,3)4/h1,3H2,(H,4,5);1H3,(H,2,3,4).
What are the key properties of 2-aminoacetic acid;methanesulfonic acid?
2-aminoacetic acid;methanesulfonic acid has a molecular weight of 171.17 g/mol, XLogP of -1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;methanesulfonic acid is sourced from PubChem (CID 135324111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).