C22H23FN4O5 — CID 135324132
[(2S)-5-(carboxyamino)-1-[[4-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]pentan-2-yl]carbamic acid (PubChem CID 135324132) has the molecular formula C22H23FN4O5 and a molecular weight of 442.45 g/mol. Its IUPAC name is [(2S)-5-(carboxyamino)-1-[[4-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]pentan-2-yl]carbamic acid.
| Compound Name | [(2S)-5-(carboxyamino)-1-[[4-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 135324132 |
| Molecular Formula | C22H23FN4O5 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [(2S)-5-(carboxyamino)-1-[[4-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]pentan-2-yl]carbamic acid |
| SMILES | O=C(O)NCCC[C@@H](CNC(=O)c1cc2c(-c3ccc(F)cc3)cccc2[nH]1)NC(=O)O |
| InChI | InChI=1S/C22H23FN4O5/c23-14-8-6-13(7-9-14)16-4-1-5-18-17(16)11-19(27-18)20(28)25-12-15(26-22(31)32)3-2-10-24-21(29)30/h1,4-9,11,15,24,26-27H,2-3,10,12H2,(H,25,28)(H,29,30)(H,31,32)/t15-/m0/s1 |
| InChIKey | AATQIWMMHXRLQU-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|