C21H24F3NO10 — CID 135324141
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate (PubChem CID 135324141) has the molecular formula C21H24F3NO10 and a molecular weight of 507.41 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 135324141 |
| Molecular Formula | C21H24F3NO10 |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate |
| SMILES | CNc1cc(C(F)(F)F)ccc1O[C@@H]1O[C@H](C(=O)OC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24F3NO10/c1-9(26)31-15-16(32-10(2)27)18(33-11(3)28)20(35-17(15)19(29)30-5)34-14-7-6-12(21(22,23)24)8-13(14)25-4/h6-8,15-18,20,25H,1-5H3/t15-,16-,17-,18+,20+/m0/s1 |
| InChIKey | DFHABDZSUGIAOQ-KVIJGQROSA-N |
| XLogP | 1.82 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|