C5H2F8O — CID 135324373
(2S,3S)-2-fluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxirane (PubChem CID 135324373) has the molecular formula C5H2F8O and a molecular weight of 230.05 g/mol. Its IUPAC name is (2S,3S)-2-fluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxirane.
| Compound Name | (2S,3S)-2-fluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxirane |
|---|---|
| PubChem CID | 135324373 |
| Molecular Formula | C5H2F8O |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | (2S,3S)-2-fluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxirane |
| SMILES | F[C@@H]1O[C@H]1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F8O/c6-2-1(14-2)3(7,4(8,9)10)5(11,12)13/h1-2H/t1-,2-/m1/s1 |
| InChIKey | VJWFFHMRCKCZDR-JCYAYHJZSA-N |
| XLogP | 2.51 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|