C20H22F3NO10 — CID 135324467
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate (PubChem CID 135324467) has the molecular formula C20H22F3NO10 and a molecular weight of 493.39 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 135324467 |
| Molecular Formula | C20H22F3NO10 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C(F)(F)F)cc2N)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H22F3NO10/c1-8(25)30-14-15(31-9(2)26)17(32-10(3)27)19(34-16(14)18(28)29-4)33-13-6-5-11(7-12(13)24)20(21,22)23/h5-7,14-17,19H,24H2,1-4H3/t14-,15-,16-,17+,19+/m0/s1 |
| InChIKey | XNJHHXOMKNYINZ-YTGMWSOZSA-N |
| XLogP | 1.36 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|