C14H16N6O5S — CID 135325090
[3-[5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,2,4-oxadiazol-3-yl]cyclobutyl] methanesulfonate (PubChem CID 135325090) has the molecular formula C14H16N6O5S and a molecular weight of 380.39 g/mol. Its IUPAC name is [3-[5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,2,4-oxadiazol-3-yl]cyclobutyl] methanesulfonate.
| Compound Name | [3-[5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,2,4-oxadiazol-3-yl]cyclobutyl] methanesulfonate |
|---|---|
| PubChem CID | 135325090 |
| Molecular Formula | C14H16N6O5S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [3-[5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,2,4-oxadiazol-3-yl]cyclobutyl] methanesulfonate |
| SMILES | Cn1cnc2ncn(Cc3nc(C4CC(OS(C)(=O)=O)C4)no3)c(=O)c21 |
| InChI | InChI=1S/C14H16N6O5S/c1-19-6-15-13-11(19)14(21)20(7-16-13)5-10-17-12(18-24-10)8-3-9(4-8)25-26(2,22)23/h6-9H,3-5H2,1-2H3 |
| InChIKey | WNHURJQDZFFGDF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 135.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|